C24H38O2 — CID 134864868
(2R,3R)-2-butyl-3-[(2Z,4Z)-6-[(2R,3R)-2-butyl-3,6-dihydro-2H-pyran-3-yl]hexa-2,4-dienyl]-3,6-dihydro-2H-pyran (PubChem CID 134864868) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is (2R,3R)-2-butyl-3-[(2Z,4Z)-6-[(2R,3R)-2-butyl-3,6-dihydro-2H-pyran-3-yl]hexa-2,4-dienyl]-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3R)-2-butyl-3-[(2Z,4Z)-6-[(2R,3R)-2-butyl-3,6-dihydro-2H-pyran-3-yl]hexa-2,4-dienyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134864868 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | (2R,3R)-2-butyl-3-[(2Z,4Z)-6-[(2R,3R)-2-butyl-3,6-dihydro-2H-pyran-3-yl]hexa-2,4-dienyl]-3,6-dihydro-2H-pyran |
| SMILES | CCCC[C@H]1OCC=C[C@H]1C/C=C\C=C/C[C@@H]1C=CCO[C@@H]1CCCC |
| InChI | InChI=1S/C24H38O2/c1-3-5-17-23-21(15-11-19-25-23)13-9-7-8-10-14-22-16-12-20-26-24(22)18-6-4-2/h7-12,15-16,21-24H,3-6,13-14,17-20H2,1-2H3/b9-7-,10-8-/t21-,22-,23-,24-/m1/s1 |
| InChIKey | KJBJTUCKABVQRX-KFTFQPCQSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|