C20H30O8S — CID 134864883
[(3aR,6S,6aS)-6-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134864883) has the molecular formula C20H30O8S and a molecular weight of 430.52 g/mol. Its IUPAC name is [(3aR,6S,6aS)-6-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aR,6S,6aS)-6-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134864883 |
| Molecular Formula | C20H30O8S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [(3aR,6S,6aS)-6-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COC(C)(C)OC[C@@H]1OC(COS(=O)(=O)c2ccc(C)cc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C20H30O8S/c1-13-7-9-14(10-8-13)29(21,22)25-12-16-18-17(27-20(4,5)28-18)15(26-16)11-24-19(2,3)23-6/h7-10,15-18H,11-12H2,1-6H3/t15-,16?,17-,18+/m0/s1 |
| InChIKey | JRKQMUAASMIAGP-OOKSDGMUSA-N |
| XLogP | 2.39 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|