About [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium
[1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium (PubChem CID 134864887) has the molecular formula C11H19O2+
and a molecular weight of 183.27 g/mol. Its IUPAC name is [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium.
Molecular Properties
| Compound Name | [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium |
| PubChem CID | 134864887 |
| Molecular Formula | C11H19O2+ |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium |
| SMILES | [H]/[O+]=C(\O)CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C11H18O2/c1-8-5-4-6-11(2,3)9(8)7-10(12)13/h4-7H2,1-3H3,(H,12,13)/p+1 |
| InChIKey | CCIVDDLKQSQGEZ-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium?
The IUPAC name of [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium (CID 134864887) is [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium.
What is the SMILES notation for [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium?
The canonical SMILES for [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium is [H]/[O+]=C(\O)CC1=C(C)CCCC1(C)C.
What is the InChIKey of [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium?
The InChIKey is CCIVDDLKQSQGEZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H18O2/c1-8-5-4-6-11(2,3)9(8)7-10(12)13/h4-7H2,1-3H3,(H,12,13)/p+1.
What are the key properties of [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium?
[1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium has a molecular weight of 183.27 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [1-hydroxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]oxidanium is sourced from PubChem (CID 134864887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).