About methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate
methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate (PubChem CID 134864944) has the molecular formula C16H23NO5
and a molecular weight of 309.36 g/mol. Its IUPAC name is methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate |
| PubChem CID | 134864944 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)[nH]c(C(=O)C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C16H23NO5/c1-9-11(7-8-12(18)21-6)10(2)17-13(9)14(19)15(20)22-16(3,4)5/h17H,7-8H2,1-6H3 |
| InChIKey | YKOMUMJWOONKKT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate?
The IUPAC name of methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate (CID 134864944) is methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate.
What is the SMILES notation for methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate?
The canonical SMILES for methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate is COC(=O)CCc1c(C)[nH]c(C(=O)C(=O)OC(C)(C)C)c1C.
What is the InChIKey of methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate?
The InChIKey is YKOMUMJWOONKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO5/c1-9-11(7-8-12(18)21-6)10(2)17-13(9)14(19)15(20)22-16(3,4)5/h17H,7-8H2,1-6H3.
What are the key properties of methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate?
methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate has a molecular weight of 309.36 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2,4-dimethyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]-1H-pyrrol-3-yl]propanoate is sourced from PubChem (CID 134864944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).