C29H54O2Si2 — CID 134865047
tert-butyl-[(3S)-9,9-dimethyl-8-tri(propan-2-yl)silyloxydodec-11-en-1,6-diyn-3-yl]oxy-dimethylsilane (PubChem CID 134865047) has the molecular formula C29H54O2Si2 and a molecular weight of 490.92 g/mol. Its IUPAC name is tert-butyl-[(3S)-9,9-dimethyl-8-tri(propan-2-yl)silyloxydodec-11-en-1,6-diyn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S)-9,9-dimethyl-8-tri(propan-2-yl)silyloxydodec-11-en-1,6-diyn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134865047 |
| Molecular Formula | C29H54O2Si2 |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | tert-butyl-[(3S)-9,9-dimethyl-8-tri(propan-2-yl)silyloxydodec-11-en-1,6-diyn-3-yl]oxy-dimethylsilane |
| SMILES | C#C[C@H](CCC#CC(O[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O2Si2/c1-16-22-29(12,13)27(31-33(23(3)4,24(5)6)25(7)8)21-19-18-20-26(17-2)30-32(14,15)28(9,10)11/h2,16,23-27H,1,18,20,22H2,3-15H3/t26-,27?/m1/s1 |
| InChIKey | LZTARENYCWBJDF-AVJYQCBHSA-N |
| XLogP | 8.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|