C12H21NO8 — CID 134865068
methyl (1S,5S,8S)-8,9,10-trihydroxy-3,7-bis(hydroxymethyl)-6-oxa-2-azaspiro[4.5]decane-1-carboxylate (PubChem CID 134865068) has the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. Its IUPAC name is methyl (1S,5S,8S)-8,9,10-trihydroxy-3,7-bis(hydroxymethyl)-6-oxa-2-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | methyl (1S,5S,8S)-8,9,10-trihydroxy-3,7-bis(hydroxymethyl)-6-oxa-2-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 134865068 |
| Molecular Formula | C12H21NO8 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | methyl (1S,5S,8S)-8,9,10-trihydroxy-3,7-bis(hydroxymethyl)-6-oxa-2-azaspiro[4.5]decane-1-carboxylate |
| SMILES | COC(=O)[C@H]1NC(CO)C[C@]12OC(CO)[C@@H](O)C(O)C2O |
| InChI | InChI=1S/C12H21NO8/c1-20-11(19)9-12(2-5(3-14)13-9)10(18)8(17)7(16)6(4-15)21-12/h5-10,13-18H,2-4H2,1H3/t5?,6?,7-,8?,9-,10?,12+/m1/s1 |
| InChIKey | QZXFWGCTSBYGRG-BYQCXMSUSA-N |
| XLogP | -3.91 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |