C23H30O5S — CID 134865071
ethyl 1-[(E)-4-(4-methylphenyl)sulfonyloxybut-1-enyl]-2,3,4,5,6,7-hexahydroindene-3a-carboxylate (PubChem CID 134865071) has the molecular formula C23H30O5S and a molecular weight of 418.56 g/mol. Its IUPAC name is ethyl 1-[(E)-4-(4-methylphenyl)sulfonyloxybut-1-enyl]-2,3,4,5,6,7-hexahydroindene-3a-carboxylate.
| Compound Name | ethyl 1-[(E)-4-(4-methylphenyl)sulfonyloxybut-1-enyl]-2,3,4,5,6,7-hexahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 134865071 |
| Molecular Formula | C23H30O5S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | ethyl 1-[(E)-4-(4-methylphenyl)sulfonyloxybut-1-enyl]-2,3,4,5,6,7-hexahydroindene-3a-carboxylate |
| SMILES | CCOC(=O)C12CCCCC1=C(/C=C/CCOS(=O)(=O)c1ccc(C)cc1)CC2 |
| InChI | InChI=1S/C23H30O5S/c1-3-27-22(24)23-15-6-4-9-21(23)19(14-16-23)8-5-7-17-28-29(25,26)20-12-10-18(2)11-13-20/h5,8,10-13H,3-4,6-7,9,14-17H2,1-2H3/b8-5+ |
| InChIKey | QYWUWFICZSQTKD-VMPITWQZSA-N |
| XLogP | 4.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|