C8H14 — CID 134865079
(1R,2R,3S,4S)-2,3-dimethylbicyclo[2.2.0]hexane (PubChem CID 134865079) has the molecular formula C8H14 and a molecular weight of 110.20 g/mol. Its IUPAC name is (1R,2R,3S,4S)-2,3-dimethylbicyclo[2.2.0]hexane.
| Compound Name | (1R,2R,3S,4S)-2,3-dimethylbicyclo[2.2.0]hexane |
|---|---|
| PubChem CID | 134865079 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | (1R,2R,3S,4S)-2,3-dimethylbicyclo[2.2.0]hexane |
| SMILES | C[C@@H]1[C@H](C)[C@@H]2CC[C@H]12 |
| InChI | InChI=1S/C8H14/c1-5-6(2)8-4-3-7(5)8/h5-8H,3-4H2,1-2H3/t5-,6+,7-,8+ |
| InChIKey | WRRMLCVKOQBYOJ-KVFPUHGPSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |