C21H36O2Si — CID 134865090
(1S,3aR,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-3a,5,5,7a-tetramethyl-2,3,6,7-tetrahydro-1H-cyclopenta[a]pentalen-4-one (PubChem CID 134865090) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (1S,3aR,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-3a,5,5,7a-tetramethyl-2,3,6,7-tetrahydro-1H-cyclopenta[a]pentalen-4-one.
| Compound Name | (1S,3aR,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-3a,5,5,7a-tetramethyl-2,3,6,7-tetrahydro-1H-cyclopenta[a]pentalen-4-one |
|---|---|
| PubChem CID | 134865090 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (1S,3aR,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-3a,5,5,7a-tetramethyl-2,3,6,7-tetrahydro-1H-cyclopenta[a]pentalen-4-one |
| SMILES | CC1(C)CC2=C(C1=O)[C@]1(C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)C2 |
| InChI | InChI=1S/C21H36O2Si/c1-18(2,3)24(8,9)23-15-10-11-20(6)16-14(13-21(15,20)7)12-19(4,5)17(16)22/h15H,10-13H2,1-9H3/t15-,20-,21-/m0/s1 |
| InChIKey | ADSYBDKFXVQXOG-JHVJFLLYSA-N |
| XLogP | 5.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|