C19H37NO4Si — CID 134865102
tert-butyl N-[(1R,2S,6S)-2-hydroxy-6-methoxy-5,7-dimethyl-3-(trimethylsilylmethyl)cyclohept-3-en-1-yl]carbamate (PubChem CID 134865102) has the molecular formula C19H37NO4Si and a molecular weight of 371.59 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,6S)-2-hydroxy-6-methoxy-5,7-dimethyl-3-(trimethylsilylmethyl)cyclohept-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,6S)-2-hydroxy-6-methoxy-5,7-dimethyl-3-(trimethylsilylmethyl)cyclohept-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 134865102 |
| Molecular Formula | C19H37NO4Si |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | tert-butyl N-[(1R,2S,6S)-2-hydroxy-6-methoxy-5,7-dimethyl-3-(trimethylsilylmethyl)cyclohept-3-en-1-yl]carbamate |
| SMILES | CO[C@H]1C(C)C=C(C[Si](C)(C)C)[C@H](O)[C@H](NC(=O)OC(C)(C)C)C1C |
| InChI | InChI=1S/C19H37NO4Si/c1-12-10-14(11-25(7,8)9)16(21)15(13(2)17(12)23-6)20-18(22)24-19(3,4)5/h10,12-13,15-17,21H,11H2,1-9H3,(H,20,22)/t12?,13?,15-,16+,17+/m1/s1 |
| InChIKey | VVGPWERRYSSPEU-OQYIOPRESA-N |
| XLogP | 3.81 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|