C25H44O2Si — CID 134865170
(4R)-4-[2-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-4-methylcyclohex-2-en-1-one (PubChem CID 134865170) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is (4R)-4-[2-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-4-methylcyclohex-2-en-1-one.
| Compound Name | (4R)-4-[2-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-4-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134865170 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (4R)-4-[2-[(1S,2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]ethyl]-4-methylcyclohex-2-en-1-one |
| SMILES | CC1(C)[C@@H]2C[C@H]1[C@@](C)(CC[C@@]1(C)C=CC(=O)CC1)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O2Si/c1-22(2,3)28(8,9)27-20-17-25(7,21-16-19(20)23(21,4)5)15-14-24(6)12-10-18(26)11-13-24/h10,12,19-21H,11,13-17H2,1-9H3/t19-,20+,21-,24+,25+/m1/s1 |
| InChIKey | FIGHIFMJWSCMDJ-WLAGUEDKSA-N |
| XLogP | 7.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|