C18H32O4Si — CID 134865245
ethyl (4aS,5S,8aR)-2,2-ditert-butyl-4a,5,6,8a-tetrahydro-4H-1,3,2-benzodioxasiline-5-carboxylate (PubChem CID 134865245) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is ethyl (4aS,5S,8aR)-2,2-ditert-butyl-4a,5,6,8a-tetrahydro-4H-1,3,2-benzodioxasiline-5-carboxylate.
| Compound Name | ethyl (4aS,5S,8aR)-2,2-ditert-butyl-4a,5,6,8a-tetrahydro-4H-1,3,2-benzodioxasiline-5-carboxylate |
|---|---|
| PubChem CID | 134865245 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | ethyl (4aS,5S,8aR)-2,2-ditert-butyl-4a,5,6,8a-tetrahydro-4H-1,3,2-benzodioxasiline-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC=C[C@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]12 |
| InChI | InChI=1S/C18H32O4Si/c1-8-20-16(19)13-10-9-11-15-14(13)12-21-23(22-15,17(2,3)4)18(5,6)7/h9,11,13-15H,8,10,12H2,1-7H3/t13-,14+,15+/m0/s1 |
| InChIKey | MOCNLHIKBAFVMC-RRFJBIMHSA-N |
| XLogP | 4.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|