C30H34O6S — CID 134865248
S-[[(3S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] ethanethioate (PubChem CID 134865248) has the molecular formula C30H34O6S and a molecular weight of 522.66 g/mol. Its IUPAC name is S-[[(3S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(3S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 134865248 |
| Molecular Formula | C30H34O6S |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | S-[[(3S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] ethanethioate |
| SMILES | CO[C@H]1OC(CSC(C)=O)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O6S/c1-22(31)37-21-26-27(33-18-23-12-6-3-7-13-23)28(34-19-24-14-8-4-9-15-24)29(30(32-2)36-26)35-20-25-16-10-5-11-17-25/h3-17,26-30H,18-21H2,1-2H3/t26?,27-,28?,29?,30+/m1/s1 |
| InChIKey | IYJRXQRVVGWICH-SKFMPKQFSA-N |
| XLogP | 5.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|