C29H34O8S — CID 134865333
[(3R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl methanesulfonate (PubChem CID 134865333) has the molecular formula C29H34O8S and a molecular weight of 542.65 g/mol. Its IUPAC name is [(3R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl methanesulfonate.
| Compound Name | [(3R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 134865333 |
| Molecular Formula | C29H34O8S |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | [(3R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl methanesulfonate |
| SMILES | CO[C@H]1OC(COS(C)(=O)=O)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H34O8S/c1-32-29-28(35-20-24-16-10-5-11-17-24)27(34-19-23-14-8-4-9-15-23)26(25(37-29)21-36-38(2,30)31)33-18-22-12-6-3-7-13-22/h3-17,25-29H,18-21H2,1-2H3/t25?,26-,27?,28?,29+/m1/s1 |
| InChIKey | YNEHHLPWLJUARD-RMDMWAKJSA-N |
| XLogP | 4.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|