C56H62O10S — CID 134865334
(4S)-2-methoxy-6-[[(3S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylsulfanylmethyl]-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 134865334) has the molecular formula C56H62O10S and a molecular weight of 927.17 g/mol. Its IUPAC name is (4S)-2-methoxy-6-[[(3S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylsulfanylmethyl]-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (4S)-2-methoxy-6-[[(3S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylsulfanylmethyl]-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 134865334 |
| Molecular Formula | C56H62O10S |
| Molecular Weight | 927.17 g/mol |
| Exact Mass | 926.41 |
| IUPAC Name | (4S)-2-methoxy-6-[[(3S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methylsulfanylmethyl]-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | COC1OC(CSCC2O[C@H](OC)C(OCc3ccccc3)C(OCc3ccccc3)[C@@H]2OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C56H62O10S/c1-57-55-53(63-37-45-29-17-7-18-30-45)51(61-35-43-25-13-5-14-26-43)49(59-33-41-21-9-3-10-22-41)47(65-55)39-67-40-48-50(60-34-42-23-11-4-12-24-42)52(62-36-44-27-15-6-16-28-44)54(56(58-2)66-48)64-38-46-31-19-8-20-32-46/h3-32,47-56H,33-40H2,1-2H3/t47?,48?,49-,50?,51?,52+,53?,54?,55+,56?/m1/s1 |
| InChIKey | GRNGKIHDKPOWOY-GSYPIHSDSA-N |
| XLogP | 9.97 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.17 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |