C19H19NO4S — CID 134865521
(4S,7S,8aS)-7-(benzenesulfonyl)-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 134865521) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is (4S,7S,8aS)-7-(benzenesulfonyl)-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | (4S,7S,8aS)-7-(benzenesulfonyl)-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 134865521 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (4S,7S,8aS)-7-(benzenesulfonyl)-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N2C[C@@H](S(=O)(=O)c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C19H19NO4S/c21-19-17-11-16(25(22,23)15-9-5-2-6-10-15)12-20(17)18(13-24-19)14-7-3-1-4-8-14/h1-10,16-18H,11-13H2/t16-,17-,18+/m0/s1 |
| InChIKey | FOLZGMCEKJGIGL-OKZBNKHCSA-N |
| XLogP | 2.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |