C20H34O4 — CID 134865546
(1R,3S,6R,8aR)-3-hydroxy-6-(5-hydroxy-3-oxopentyl)-6,8a-dimethyl-1-propan-2-yl-2,3,3a,4,7,8-hexahydro-1H-azulen-5-one (PubChem CID 134865546) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (1R,3S,6R,8aR)-3-hydroxy-6-(5-hydroxy-3-oxopentyl)-6,8a-dimethyl-1-propan-2-yl-2,3,3a,4,7,8-hexahydro-1H-azulen-5-one.
| Compound Name | (1R,3S,6R,8aR)-3-hydroxy-6-(5-hydroxy-3-oxopentyl)-6,8a-dimethyl-1-propan-2-yl-2,3,3a,4,7,8-hexahydro-1H-azulen-5-one |
|---|---|
| PubChem CID | 134865546 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (1R,3S,6R,8aR)-3-hydroxy-6-(5-hydroxy-3-oxopentyl)-6,8a-dimethyl-1-propan-2-yl-2,3,3a,4,7,8-hexahydro-1H-azulen-5-one |
| SMILES | CC(C)[C@H]1C[C@H](O)C2CC(=O)[C@@](C)(CCC(=O)CCO)CC[C@@]21C |
| InChI | InChI=1S/C20H34O4/c1-13(2)15-11-17(23)16-12-18(24)19(3,8-9-20(15,16)4)7-5-14(22)6-10-21/h13,15-17,21,23H,5-12H2,1-4H3/t15-,16?,17+,19+,20-/m1/s1 |
| InChIKey | HIWMBOAJCDUNRF-UKIVXTKLSA-N |
| XLogP | 3.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |