C13H20O5 — CID 134865551
(6R,7R,14R)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane-14-carbaldehyde (PubChem CID 134865551) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (6R,7R,14R)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane-14-carbaldehyde.
| Compound Name | (6R,7R,14R)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane-14-carbaldehyde |
|---|---|
| PubChem CID | 134865551 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (6R,7R,14R)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane-14-carbaldehyde |
| SMILES | O=C[C@H]1CO[C@]2(CCCCO2)[C@@]2(CCCCO2)O1 |
| InChI | InChI=1S/C13H20O5/c14-9-11-10-17-12(5-1-3-7-15-12)13(18-11)6-2-4-8-16-13/h9,11H,1-8,10H2/t11-,12+,13+/m0/s1 |
| InChIKey | NQVVHOWPCAPLEL-YNEHKIRRSA-N |
| XLogP | 1.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|