C19H17F3O5S — CID 134865565
methyl 6-(trifluoromethylsulfonyloxy)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylate (PubChem CID 134865565) has the molecular formula C19H17F3O5S and a molecular weight of 414.40 g/mol. Its IUPAC name is methyl 6-(trifluoromethylsulfonyloxy)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylate.
| Compound Name | methyl 6-(trifluoromethylsulfonyloxy)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 134865565 |
| Molecular Formula | C19H17F3O5S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | methyl 6-(trifluoromethylsulfonyloxy)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylate |
| SMILES | COC(=O)c1c2ccc(c1OS(=O)(=O)C(F)(F)F)CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C19H17F3O5S/c1-26-18(23)16-14-8-6-12-2-4-13(5-3-12)7-9-15(11-10-14)17(16)27-28(24,25)19(20,21)22/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | XZAHHAQLKSDVHN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|