C19H21NO6 — CID 134865595
diethyl (4S,6S,8aS)-1-oxo-4-phenyl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxylate (PubChem CID 134865595) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is diethyl (4S,6S,8aS)-1-oxo-4-phenyl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxylate.
| Compound Name | diethyl (4S,6S,8aS)-1-oxo-4-phenyl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxylate |
|---|---|
| PubChem CID | 134865595 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | diethyl (4S,6S,8aS)-1-oxo-4-phenyl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](C(=O)OCC)N2[C@@H]1C(=O)OC[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C19H21NO6/c1-3-24-17(21)13-10-14(18(22)25-4-2)20-15(11-26-19(23)16(13)20)12-8-6-5-7-9-12/h5-10,14-16H,3-4,11H2,1-2H3/t14-,15+,16-/m0/s1 |
| InChIKey | ULTGAPCUAYZPIL-XHSDSOJGSA-N |
| XLogP | 1.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|