C14H22O2 — CID 134865674
(5S)-6-[(1S)-1-hydroxy-2-methylprop-2-enyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-one (PubChem CID 134865674) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (5S)-6-[(1S)-1-hydroxy-2-methylprop-2-enyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-one.
| Compound Name | (5S)-6-[(1S)-1-hydroxy-2-methylprop-2-enyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134865674 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (5S)-6-[(1S)-1-hydroxy-2-methylprop-2-enyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)[C@@H](O)C1C(=O)C(C)=CC[C@H]1C(C)C |
| InChI | InChI=1S/C14H22O2/c1-8(2)11-7-6-10(5)14(16)12(11)13(15)9(3)4/h6,8,11-13,15H,3,7H2,1-2,4-5H3/t11-,12?,13+/m0/s1 |
| InChIKey | VZOAVGZRDRBWKY-IAMFDIQRSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|