C33H34O4S — CID 134865883
(3R,6R)-2-methyl-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxane (PubChem CID 134865883) has the molecular formula C33H34O4S and a molecular weight of 526.70 g/mol. Its IUPAC name is (3R,6R)-2-methyl-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxane.
| Compound Name | (3R,6R)-2-methyl-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 134865883 |
| Molecular Formula | C33H34O4S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (3R,6R)-2-methyl-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxane |
| SMILES | CC1O[C@H](Sc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H34O4S/c1-25-30(34-22-26-14-6-2-7-15-26)31(35-23-27-16-8-3-9-17-27)32(36-24-28-18-10-4-11-19-28)33(37-25)38-29-20-12-5-13-21-29/h2-21,25,30-33H,22-24H2,1H3/t25?,30-,31?,32?,33-/m1/s1 |
| InChIKey | WGAOZACWMVPQOY-JLYJSLKMSA-N |
| XLogP | 7.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |