C17H28F3N — CID 134865894
(2S,6R)-4,4-dimethyl-2-[(1E,3E)-nona-1,3-dienyl]-6-(trifluoromethyl)piperidine (PubChem CID 134865894) has the molecular formula C17H28F3N and a molecular weight of 303.41 g/mol. Its IUPAC name is (2S,6R)-4,4-dimethyl-2-[(1E,3E)-nona-1,3-dienyl]-6-(trifluoromethyl)piperidine.
| Compound Name | (2S,6R)-4,4-dimethyl-2-[(1E,3E)-nona-1,3-dienyl]-6-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 134865894 |
| Molecular Formula | C17H28F3N |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (2S,6R)-4,4-dimethyl-2-[(1E,3E)-nona-1,3-dienyl]-6-(trifluoromethyl)piperidine |
| SMILES | CCCCC/C=C/C=C/[C@@H]1CC(C)(C)C[C@H](C(F)(F)F)N1 |
| InChI | InChI=1S/C17H28F3N/c1-4-5-6-7-8-9-10-11-14-12-16(2,3)13-15(21-14)17(18,19)20/h8-11,14-15,21H,4-7,12-13H2,1-3H3/b9-8+,11-10+/t14-,15-/m1/s1 |
| InChIKey | QGDNPABFYNSMOL-SHQQZNEKSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|