About [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol
[(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol (PubChem CID 134865899) has the molecular formula C5H11NO2
and a molecular weight of 119.16 g/mol. Its IUPAC name is [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol |
| PubChem CID | 134865899 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol |
| SMILES | [3H][C@H]1C[C@@H](N)[C@@H](CO)O1 |
| InChI | InChI=1S/C5H11NO2/c6-4-1-2-8-5(4)3-7/h4-5,7H,1-3,6H2/t4-,5-/m1/s1/i2T/t2-,4+,5+/m0 |
| InChIKey | IGQVNANAWQMFRK-WVXSJSFTSA-N |
| XLogP | -0.91 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol?
The IUPAC name of [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol (CID 134865899) is [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol.
What is the SMILES notation for [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol?
The canonical SMILES for [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol is [3H][C@H]1C[C@@H](N)[C@@H](CO)O1.
What is the InChIKey of [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol?
The InChIKey is IGQVNANAWQMFRK-WVXSJSFTSA-N. The full InChI is InChI=1S/C5H11NO2/c6-4-1-2-8-5(4)3-7/h4-5,7H,1-3,6H2/t4-,5-/m1/s1/i2T/t2-,4+,5+/m0.
What are the key properties of [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol?
[(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol has a molecular weight of 119.16 g/mol, XLogP of -0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R,5S)-3-amino-5-tritiooxolan-2-yl]methanol is sourced from PubChem (CID 134865899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).