C18H36O2Si — CID 134865997
(E,2R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-en-3-one (PubChem CID 134865997) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (E,2R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-en-3-one.
| Compound Name | (E,2R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-en-3-one |
|---|---|
| PubChem CID | 134865997 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (E,2R,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-4-en-3-one |
| SMILES | CCC[C@@H](C)/C=C(\C)C(=O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-10-11-14(2)12-15(3)17(19)16(4)13-20-21(8,9)18(5,6)7/h12,14,16H,10-11,13H2,1-9H3/b15-12+/t14-,16-/m1/s1 |
| InChIKey | GZPIZHJYRXFKKJ-BTAXDJAESA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|