C13H24O2 — CID 134866009
(4R,5S,6S)-4-but-3-en-2-yl-6-ethyl-2,2,5-trimethyl-1,3-dioxane (PubChem CID 134866009) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (4R,5S,6S)-4-but-3-en-2-yl-6-ethyl-2,2,5-trimethyl-1,3-dioxane.
| Compound Name | (4R,5S,6S)-4-but-3-en-2-yl-6-ethyl-2,2,5-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 134866009 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (4R,5S,6S)-4-but-3-en-2-yl-6-ethyl-2,2,5-trimethyl-1,3-dioxane |
| SMILES | C=CC(C)[C@H]1OC(C)(C)O[C@@H](CC)[C@@H]1C |
| InChI | InChI=1S/C13H24O2/c1-7-9(3)12-10(4)11(8-2)14-13(5,6)15-12/h7,9-12H,1,8H2,2-6H3/t9?,10-,11-,12+/m0/s1 |
| InChIKey | FOPLUSIGBMFWSZ-HSTDOPHLSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|