C25H33N3O4SSi — CID 134866102
2-[[(6S,8aR)-6-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]sulfanyl]ethyl-trimethylsilane (PubChem CID 134866102) has the molecular formula C25H33N3O4SSi and a molecular weight of 499.71 g/mol. Its IUPAC name is 2-[[(6S,8aR)-6-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]sulfanyl]ethyl-trimethylsilane.
| Compound Name | 2-[[(6S,8aR)-6-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]sulfanyl]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 134866102 |
| Molecular Formula | C25H33N3O4SSi |
| Molecular Weight | 499.71 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 2-[[(6S,8aR)-6-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]sulfanyl]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCSC1C(OCc2ccccc2)[C@@H]2OC(c3ccccc3)OCC2O[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C25H33N3O4SSi/c1-34(2,3)15-14-33-23-22(29-16-18-10-6-4-7-11-18)21-20(31-24(23)27-28-26)17-30-25(32-21)19-12-8-5-9-13-19/h4-13,20-25H,14-17H2,1-3H3/t20?,21-,22?,23?,24+,25?/m1/s1 |
| InChIKey | ARUOCIGCJMADIO-RSFQPNPYSA-N |
| XLogP | 6.16 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.71 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|