About S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate
S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate (PubChem CID 134866172) has the molecular formula C21H34O2S
and a molecular weight of 350.57 g/mol. Its IUPAC name is S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate.
Molecular Properties
| Compound Name | S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate |
| PubChem CID | 134866172 |
| Molecular Formula | C21H34O2S |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate |
| SMILES | C=C(C)C[C@@]1(C)C(=O)CC[C@@H]1[C@@H](CCC=CC)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C21H34O2S/c1-8-9-10-11-16(19(23)24-20(4,5)6)17-12-13-18(22)21(17,7)14-15(2)3/h8-9,16-17H,2,10-14H2,1,3-7H3/t16-,17-,21-/m1/s1 |
| InChIKey | HMKXIXSFMUVNRT-CBGDNZLLSA-N |
| XLogP | 5.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate?
The IUPAC name of S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate (CID 134866172) is S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate.
What is the SMILES notation for S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate?
The canonical SMILES for S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate is C=C(C)C[C@@]1(C)C(=O)CC[C@@H]1[C@@H](CCC=CC)C(=O)SC(C)(C)C.
What is the InChIKey of S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate?
The InChIKey is HMKXIXSFMUVNRT-CBGDNZLLSA-N. The full InChI is InChI=1S/C21H34O2S/c1-8-9-10-11-16(19(23)24-20(4,5)6)17-12-13-18(22)21(17,7)14-15(2)3/h8-9,16-17H,2,10-14H2,1,3-7H3/t16-,17-,21-/m1/s1.
What are the key properties of S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate?
S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate has a molecular weight of 350.57 g/mol, XLogP of 5.97, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butyl (2R)-2-[(1R,2R)-2-methyl-2-(2-methylprop-2-enyl)-3-oxocyclopentyl]hept-5-enethioate is sourced from PubChem (CID 134866172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).