C18H38O4Si — CID 134866190
(2S,3S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylhexan-2-ol (PubChem CID 134866190) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is (2S,3S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylhexan-2-ol.
| Compound Name | (2S,3S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylhexan-2-ol |
|---|---|
| PubChem CID | 134866190 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (2S,3S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylhexan-2-ol |
| SMILES | C[C@H](C[C@H](C)[C@H](O)CO[Si](C)(C)C(C)(C)C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C18H38O4Si/c1-13(10-14(2)16-12-20-18(6,7)22-16)15(19)11-21-23(8,9)17(3,4)5/h13-16,19H,10-12H2,1-9H3/t13-,14+,15+,16?/m0/s1 |
| InChIKey | SDIQASOYJWGYLI-BZZKYOCZSA-N |
| XLogP | 4.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|