C18H29NO7 — CID 134866230
1-O-tert-butyl 2-O-methyl (3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[(2S)-4-oxobutan-2-yl]pyrrolidine-1,2-dicarboxylate (PubChem CID 134866230) has the molecular formula C18H29NO7 and a molecular weight of 371.43 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[(2S)-4-oxobutan-2-yl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[(2S)-4-oxobutan-2-yl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134866230 |
| Molecular Formula | C18H29NO7 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[(2S)-4-oxobutan-2-yl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C[C@@H]1C(C(=O)OC)N(C(=O)OC(C)(C)C)C[C@H]1[C@@H](C)CC=O |
| InChI | InChI=1S/C18H29NO7/c1-11(7-8-20)13-10-19(17(23)26-18(2,3)4)15(16(22)25-6)12(13)9-14(21)24-5/h8,11-13,15H,7,9-10H2,1-6H3/t11-,12-,13-,15?/m0/s1 |
| InChIKey | WKAPSWJYKTZHPX-BOEIJXPTSA-N |
| XLogP | 1.80 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|