About (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate
(3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate (PubChem CID 134866337) has the molecular formula C8H9Cl3O2
and a molecular weight of 244.52 g/mol. Its IUPAC name is (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate.
Molecular Properties
| Compound Name | (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate |
| PubChem CID | 134866337 |
| Molecular Formula | C8H9Cl3O2 |
| Molecular Weight | 244.52 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate |
| SMILES | [2H]C1=CC(OC(=O)C(Cl)(Cl)Cl)CCC1 |
| InChI | InChI=1S/C8H9Cl3O2/c9-8(10,11)7(12)13-6-4-2-1-3-5-6/h2,4,6H,1,3,5H2/i2D |
| InChIKey | FCKUQSZKVCGUON-VMNATFBRSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate?
The IUPAC name of (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate (CID 134866337) is (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate.
What is the SMILES notation for (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate?
The canonical SMILES for (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate is [2H]C1=CC(OC(=O)C(Cl)(Cl)Cl)CCC1.
What is the InChIKey of (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate?
The InChIKey is FCKUQSZKVCGUON-VMNATFBRSA-N. The full InChI is InChI=1S/C8H9Cl3O2/c9-8(10,11)7(12)13-6-4-2-1-3-5-6/h2,4,6H,1,3,5H2/i2D.
What are the key properties of (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate?
(3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate has a molecular weight of 244.52 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-deuteriocyclohex-2-en-1-yl) 2,2,2-trichloroacetate is sourced from PubChem (CID 134866337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).