C25H33N3O5 — CID 134866345
prop-2-enyl 2-[[(2S)-4-methyl-2-[[(2R)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetate (PubChem CID 134866345) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is prop-2-enyl 2-[[(2S)-4-methyl-2-[[(2R)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetate.
| Compound Name | prop-2-enyl 2-[[(2S)-4-methyl-2-[[(2R)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 134866345 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | prop-2-enyl 2-[[(2S)-4-methyl-2-[[(2R)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetate |
| SMILES | C=CCOC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H]1CCCN1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H33N3O5/c1-4-15-33-23(30)17-26-24(31)20(16-18(2)3)27-25(32)21-11-8-14-28(21)22(29)13-12-19-9-6-5-7-10-19/h4-7,9-10,12-13,18,20-21H,1,8,11,14-17H2,2-3H3,(H,26,31)(H,27,32)/b13-12+/t20-,21+/m0/s1 |
| InChIKey | ZQGRMFPFYXGLJN-BOZGQFBRSA-N |
| XLogP | 2.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|