C14H24O7 — CID 134866358
ethyl 3-[(3aS,6R)-7-hydroxy-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]propanoate (PubChem CID 134866358) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is ethyl 3-[(3aS,6R)-7-hydroxy-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]propanoate.
| Compound Name | ethyl 3-[(3aS,6R)-7-hydroxy-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]propanoate |
|---|---|
| PubChem CID | 134866358 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | ethyl 3-[(3aS,6R)-7-hydroxy-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]propanoate |
| SMILES | CCOC(=O)CCC1O[C@@H](OC)C(O)C2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H24O7/c1-5-18-9(15)7-6-8-11-12(21-14(2,3)20-11)10(16)13(17-4)19-8/h8,10-13,16H,5-7H2,1-4H3/t8?,10?,11-,12?,13+/m0/s1 |
| InChIKey | CHYXFNXPJHZMIQ-YSLUSRFGSA-N |
| XLogP | 0.58 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |