About (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate
(1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 134866440) has the molecular formula C19H24N2O4
and a molecular weight of 344.41 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
Molecular Properties
| Compound Name | (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| PubChem CID | 134866440 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CCN1CCC(OC(=O)c2ccccc2N2C(=O)CC(C)C2=O)CC1 |
| InChI | InChI=1S/C19H24N2O4/c1-3-20-10-8-14(9-11-20)25-19(24)15-6-4-5-7-16(15)21-17(22)12-13(2)18(21)23/h4-7,13-14H,3,8-12H2,1-2H3 |
| InChIKey | RPTPUHQHJSSFJW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate?
The IUPAC name of (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (CID 134866440) is (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
What is the SMILES notation for (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate?
The canonical SMILES for (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate is CCN1CCC(OC(=O)c2ccccc2N2C(=O)CC(C)C2=O)CC1.
What is the InChIKey of (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate?
The InChIKey is RPTPUHQHJSSFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O4/c1-3-20-10-8-14(9-11-20)25-19(24)15-6-4-5-7-16(15)21-17(22)12-13(2)18(21)23/h4-7,13-14H,3,8-12H2,1-2H3.
What are the key properties of (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate?
(1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate has a molecular weight of 344.41 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-4-yl) 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate is sourced from PubChem (CID 134866440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).