About 2-(1-phenylethyl)-1,3-dithiane 1-oxide
2-(1-phenylethyl)-1,3-dithiane 1-oxide (PubChem CID 134866609) has the molecular formula C12H16OS2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(1-phenylethyl)-1,3-dithiane 1-oxide.
Molecular Properties
| Compound Name | 2-(1-phenylethyl)-1,3-dithiane 1-oxide |
| PubChem CID | 134866609 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-(1-phenylethyl)-1,3-dithiane 1-oxide |
| SMILES | CC(c1ccccc1)C1SCCCS1=O |
| InChI | InChI=1S/C12H16OS2/c1-10(11-6-3-2-4-7-11)12-14-8-5-9-15(12)13/h2-4,6-7,10,12H,5,8-9H2,1H3 |
| InChIKey | DCIXXHJICWKBGL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-phenylethyl)-1,3-dithiane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-phenylethyl)-1,3-dithiane 1-oxide?
The IUPAC name of 2-(1-phenylethyl)-1,3-dithiane 1-oxide (CID 134866609) is 2-(1-phenylethyl)-1,3-dithiane 1-oxide.
What is the SMILES notation for 2-(1-phenylethyl)-1,3-dithiane 1-oxide?
The canonical SMILES for 2-(1-phenylethyl)-1,3-dithiane 1-oxide is CC(c1ccccc1)C1SCCCS1=O.
What is the InChIKey of 2-(1-phenylethyl)-1,3-dithiane 1-oxide?
The InChIKey is DCIXXHJICWKBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS2/c1-10(11-6-3-2-4-7-11)12-14-8-5-9-15(12)13/h2-4,6-7,10,12H,5,8-9H2,1H3.
What are the key properties of 2-(1-phenylethyl)-1,3-dithiane 1-oxide?
2-(1-phenylethyl)-1,3-dithiane 1-oxide has a molecular weight of 240.39 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenylethyl)-1,3-dithiane 1-oxide is sourced from PubChem (CID 134866609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).