C27H36O2Si2 — CID 134866622
1-[tert-butyl(diphenyl)silyl]oxy-8-trimethylsilylocta-5,7-diyn-4-ol (PubChem CID 134866622) has the molecular formula C27H36O2Si2 and a molecular weight of 448.76 g/mol. Its IUPAC name is 1-[tert-butyl(diphenyl)silyl]oxy-8-trimethylsilylocta-5,7-diyn-4-ol.
| Compound Name | 1-[tert-butyl(diphenyl)silyl]oxy-8-trimethylsilylocta-5,7-diyn-4-ol |
|---|---|
| PubChem CID | 134866622 |
| Molecular Formula | C27H36O2Si2 |
| Molecular Weight | 448.76 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-[tert-butyl(diphenyl)silyl]oxy-8-trimethylsilylocta-5,7-diyn-4-ol |
| SMILES | CC(C)(C)[Si](OCCCC(O)C#CC#C[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H36O2Si2/c1-27(2,3)31(25-18-9-7-10-19-25,26-20-11-8-12-21-26)29-22-15-17-24(28)16-13-14-23-30(4,5)6/h7-12,18-21,24,28H,15,17,22H2,1-6H3 |
| InChIKey | KFRWWGGTLFUYDO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|