About trifluoromethylbenzene;zinc
trifluoromethylbenzene;zinc (PubChem CID 134866650) has the molecular formula C7H4F3Zn-
and a molecular weight of 210.49 g/mol. Its IUPAC name is trifluoromethylbenzene;zinc.
Molecular Properties
| Compound Name | trifluoromethylbenzene;zinc |
| PubChem CID | 134866650 |
| Molecular Formula | C7H4F3Zn- |
| Molecular Weight | 210.49 g/mol |
| Exact Mass | 208.96 |
| IUPAC Name | trifluoromethylbenzene;zinc |
| SMILES | FC(F)(F)c1c[c-]ccc1.[Zn] |
| InChI | InChI=1S/C7H4F3.Zn/c8-7(9,10)6-4-2-1-3-5-6;/h1-2,4-5H;/q-1; |
| InChIKey | IBGIHCPWRHGLJL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethylbenzene;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethylbenzene;zinc?
The IUPAC name of trifluoromethylbenzene;zinc (CID 134866650) is trifluoromethylbenzene;zinc.
What is the SMILES notation for trifluoromethylbenzene;zinc?
The canonical SMILES for trifluoromethylbenzene;zinc is FC(F)(F)c1c[c-]ccc1.[Zn].
What is the InChIKey of trifluoromethylbenzene;zinc?
The InChIKey is IBGIHCPWRHGLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3.Zn/c8-7(9,10)6-4-2-1-3-5-6;/h1-2,4-5H;/q-1;.
What are the key properties of trifluoromethylbenzene;zinc?
trifluoromethylbenzene;zinc has a molecular weight of 210.49 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethylbenzene;zinc is sourced from PubChem (CID 134866650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).