C19H27NO4 — CID 134866673
1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-ethylcyclopropan-1-amine (PubChem CID 134866673) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-ethylcyclopropan-1-amine.
| Compound Name | 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-ethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 134866673 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-ethylcyclopropan-1-amine |
| SMILES | CCC1CC1(N)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO4/c1-4-13-10-19(13,20)16-14(21-11-12-8-6-5-7-9-12)15-17(22-16)24-18(2,3)23-15/h5-9,13-17H,4,10-11,20H2,1-3H3/t13?,14-,15-,16+,17-,19?/m1/s1 |
| InChIKey | ZKRAKMBMRHMNKE-HSPZGVKFSA-N |
| XLogP | 2.58 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |