C34H50O4Si2 — CID 134866675
1-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxydodeca-5,7-diyne-4,9-diol (PubChem CID 134866675) has the molecular formula C34H50O4Si2 and a molecular weight of 578.94 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxydodeca-5,7-diyne-4,9-diol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxydodeca-5,7-diyne-4,9-diol |
|---|---|
| PubChem CID | 134866675 |
| Molecular Formula | C34H50O4Si2 |
| Molecular Weight | 578.94 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxydodeca-5,7-diyne-4,9-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(O)C#CC#CC(O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H50O4Si2/c1-33(2,3)39(7,8)37-27-17-21-29(35)19-15-16-20-30(36)22-18-28-38-40(34(4,5)6,31-23-11-9-12-24-31)32-25-13-10-14-26-32/h9-14,23-26,29-30,35-36H,17-18,21-22,27-28H2,1-8H3 |
| InChIKey | WHSWVCQVZHEPDD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.94 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|