C33H46O2Si2 — CID 134866680
(6E,8E,10E)-14-[tert-butyl(diphenyl)silyl]oxy-1-trimethylsilyltetradeca-6,8,10-trien-1-yn-3-ol (PubChem CID 134866680) has the molecular formula C33H46O2Si2 and a molecular weight of 530.90 g/mol. Its IUPAC name is (6E,8E,10E)-14-[tert-butyl(diphenyl)silyl]oxy-1-trimethylsilyltetradeca-6,8,10-trien-1-yn-3-ol.
| Compound Name | (6E,8E,10E)-14-[tert-butyl(diphenyl)silyl]oxy-1-trimethylsilyltetradeca-6,8,10-trien-1-yn-3-ol |
|---|---|
| PubChem CID | 134866680 |
| Molecular Formula | C33H46O2Si2 |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | (6E,8E,10E)-14-[tert-butyl(diphenyl)silyl]oxy-1-trimethylsilyltetradeca-6,8,10-trien-1-yn-3-ol |
| SMILES | CC(C)(C)[Si](OCCC/C=C/C=C/C=C/CCC(O)C#C[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H46O2Si2/c1-33(2,3)37(31-23-17-14-18-24-31,32-25-19-15-20-26-32)35-28-21-13-11-9-7-8-10-12-16-22-30(34)27-29-36(4,5)6/h7-12,14-15,17-20,23-26,30,34H,13,16,21-22,28H2,1-6H3/b8-7+,11-9+,12-10+ |
| InChIKey | JDMAKFULFWPPHO-BGSVYHRFSA-N |
| XLogP | 7.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|