C31H40O3Si — CID 134866681
(7E,9E,11E)-15-[tert-butyl(diphenyl)silyl]oxypentadeca-7,9,11-trien-2-yne-1,4-diol (PubChem CID 134866681) has the molecular formula C31H40O3Si and a molecular weight of 488.74 g/mol. Its IUPAC name is (7E,9E,11E)-15-[tert-butyl(diphenyl)silyl]oxypentadeca-7,9,11-trien-2-yne-1,4-diol.
| Compound Name | (7E,9E,11E)-15-[tert-butyl(diphenyl)silyl]oxypentadeca-7,9,11-trien-2-yne-1,4-diol |
|---|---|
| PubChem CID | 134866681 |
| Molecular Formula | C31H40O3Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | (7E,9E,11E)-15-[tert-butyl(diphenyl)silyl]oxypentadeca-7,9,11-trien-2-yne-1,4-diol |
| SMILES | CC(C)(C)[Si](OCCC/C=C/C=C/C=C/CCC(O)C#CCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40O3Si/c1-31(2,3)35(29-22-14-11-15-23-29,30-24-16-12-17-25-30)34-27-18-10-8-6-4-5-7-9-13-20-28(33)21-19-26-32/h4-9,11-12,14-17,22-25,28,32-33H,10,13,18,20,26-27H2,1-3H3/b5-4+,8-6+,9-7+ |
| InChIKey | LUCRCJNMCMUSJI-WUJFNTSISA-N |
| XLogP | 5.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|