C27H27NO4 — CID 134866872
benzyl N-[(1R,4R,5R)-4,5-bis(phenylmethoxy)cyclopent-2-en-1-yl]carbamate (PubChem CID 134866872) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is benzyl N-[(1R,4R,5R)-4,5-bis(phenylmethoxy)cyclopent-2-en-1-yl]carbamate.
| Compound Name | benzyl N-[(1R,4R,5R)-4,5-bis(phenylmethoxy)cyclopent-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 134866872 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | benzyl N-[(1R,4R,5R)-4,5-bis(phenylmethoxy)cyclopent-2-en-1-yl]carbamate |
| SMILES | O=C(N[C@@H]1C=C[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C27H27NO4/c29-27(32-20-23-14-8-3-9-15-23)28-24-16-17-25(30-18-21-10-4-1-5-11-21)26(24)31-19-22-12-6-2-7-13-22/h1-17,24-26H,18-20H2,(H,28,29)/t24-,25-,26-/m1/s1 |
| InChIKey | BUHISBHJARKTMJ-TWJOJJKGSA-N |
| XLogP | 5.02 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|