C35H35NO4 — CID 134866877
benzyl N-[(3R,4R,5R)-1-phenyl-4,5-bis(phenylmethoxy)hepta-1,6-dien-3-yl]carbamate (PubChem CID 134866877) has the molecular formula C35H35NO4 and a molecular weight of 533.67 g/mol. Its IUPAC name is benzyl N-[(3R,4R,5R)-1-phenyl-4,5-bis(phenylmethoxy)hepta-1,6-dien-3-yl]carbamate.
| Compound Name | benzyl N-[(3R,4R,5R)-1-phenyl-4,5-bis(phenylmethoxy)hepta-1,6-dien-3-yl]carbamate |
|---|---|
| PubChem CID | 134866877 |
| Molecular Formula | C35H35NO4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | benzyl N-[(3R,4R,5R)-1-phenyl-4,5-bis(phenylmethoxy)hepta-1,6-dien-3-yl]carbamate |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](C=Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H35NO4/c1-2-33(38-25-29-17-9-4-10-18-29)34(39-26-30-19-11-5-12-20-30)32(24-23-28-15-7-3-8-16-28)36-35(37)40-27-31-21-13-6-14-22-31/h2-24,32-34H,1,25-27H2,(H,36,37)/t32-,33-,34-/m1/s1 |
| InChIKey | DIQNWWNFLZSQGI-CKOYEXALSA-N |
| XLogP | 7.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|