About tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate
tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 134866978) has the molecular formula C19H27NO2S2
and a molecular weight of 365.56 g/mol. Its IUPAC name is tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 134866978 |
| Molecular Formula | C19H27NO2S2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | C[C@@H]1CC2(C[C@@H](c3ccccc3)N1C(=O)OC(C)(C)C)SCCS2 |
| InChI | InChI=1S/C19H27NO2S2/c1-14-12-19(23-10-11-24-19)13-16(15-8-6-5-7-9-15)20(14)17(21)22-18(2,3)4/h5-9,14,16H,10-13H2,1-4H3/t14-,16+/m1/s1 |
| InChIKey | OOAWRZMZZIVDPP-ZBFHGGJFSA-N |
| XLogP | 5.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate?
The IUPAC name of tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate (CID 134866978) is tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate is C[C@@H]1CC2(C[C@@H](c3ccccc3)N1C(=O)OC(C)(C)C)SCCS2.
What is the InChIKey of tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate?
The InChIKey is OOAWRZMZZIVDPP-ZBFHGGJFSA-N. The full InChI is InChI=1S/C19H27NO2S2/c1-14-12-19(23-10-11-24-19)13-16(15-8-6-5-7-9-15)20(14)17(21)22-18(2,3)4/h5-9,14,16H,10-13H2,1-4H3/t14-,16+/m1/s1.
What are the key properties of tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate?
tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate has a molecular weight of 365.56 g/mol, XLogP of 5.32, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (7S,9R)-9-methyl-7-phenyl-1,4-dithia-8-azaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 134866978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).