C45H90O5Si3 — CID 134867137
[(4R,5S,7E,9R,10R,12R)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyltrideca-1,7-dien-4-yl] (5S)-6,8-dimethyl-5-triethylsilyloxynon-8-enoate (PubChem CID 134867137) has the molecular formula C45H90O5Si3 and a molecular weight of 795.47 g/mol. Its IUPAC name is [(4R,5S,7E,9R,10R,12R)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyltrideca-1,7-dien-4-yl] (5S)-6,8-dimethyl-5-triethylsilyloxynon-8-enoate.
| Compound Name | [(4R,5S,7E,9R,10R,12R)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyltrideca-1,7-dien-4-yl] (5S)-6,8-dimethyl-5-triethylsilyloxynon-8-enoate |
|---|---|
| PubChem CID | 134867137 |
| Molecular Formula | C45H90O5Si3 |
| Molecular Weight | 795.47 g/mol |
| Exact Mass | 794.61 |
| IUPAC Name | [(4R,5S,7E,9R,10R,12R)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyltrideca-1,7-dien-4-yl] (5S)-6,8-dimethyl-5-triethylsilyloxynon-8-enoate |
| SMILES | C=CC[C@@H](OC(=O)CCC[C@H](O[Si](CC)(CC)CC)C(C)CC(=C)C)[C@@H](C)C/C(C)=C/[C@@H](C)[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C45H90O5Si3/c1-22-27-40(47-43(46)29-26-28-41(36(8)30-34(5)6)50-53(23-2,24-3)25-4)37(9)31-35(7)32-38(10)42(49-52(20,21)45(15,16)17)33-39(11)48-51(18,19)44(12,13)14/h22,32,36-42H,1,5,23-31,33H2,2-4,6-21H3/b35-32+/t36?,37-,38+,39+,40+,41-,42+/m0/s1 |
| InChIKey | UGZMTKJVDUZBPQ-SFQUNJEBSA-N |
| XLogP | 14.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.47 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|