C28H33NO5 — CID 134867187
(3R,4R,5R,6R,7S)-5,6-bis(phenylmethoxy)-7-(phenylmethoxymethyl)azepane-3,4-diol (PubChem CID 134867187) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is (3R,4R,5R,6R,7S)-5,6-bis(phenylmethoxy)-7-(phenylmethoxymethyl)azepane-3,4-diol.
| Compound Name | (3R,4R,5R,6R,7S)-5,6-bis(phenylmethoxy)-7-(phenylmethoxymethyl)azepane-3,4-diol |
|---|---|
| PubChem CID | 134867187 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (3R,4R,5R,6R,7S)-5,6-bis(phenylmethoxy)-7-(phenylmethoxymethyl)azepane-3,4-diol |
| SMILES | O[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](COCc2ccccc2)NC[C@H]1O |
| InChI | InChI=1S/C28H33NO5/c30-25-16-29-24(20-32-17-21-10-4-1-5-11-21)27(33-18-22-12-6-2-7-13-22)28(26(25)31)34-19-23-14-8-3-9-15-23/h1-15,24-31H,16-20H2/t24-,25+,26+,27+,28+/m0/s1 |
| InChIKey | IUHWDIIMNXCEBW-DJOAIXOZSA-N |
| XLogP | 3.07 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |