About 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane
3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane (PubChem CID 134867225) has the molecular formula C20H40O3Si
and a molecular weight of 356.62 g/mol. Its IUPAC name is 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane |
| PubChem CID | 134867225 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@]1(C)CC(OCCCC)O[C@H]1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3Si/c1-9-11-14-21-18-16-20(6,10-2)17(23-18)13-12-15-22-24(7,8)19(3,4)5/h10,17-18H,2,9,11-16H2,1,3-8H3/t17-,18?,20+/m0/s1 |
| InChIKey | WVYACAJPMGKHAV-NKUTVCTDSA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane?
The IUPAC name of 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane (CID 134867225) is 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane?
The canonical SMILES for 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane is C=C[C@]1(C)CC(OCCCC)O[C@H]1CCCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane?
The InChIKey is WVYACAJPMGKHAV-NKUTVCTDSA-N. The full InChI is InChI=1S/C20H40O3Si/c1-9-11-14-21-18-16-20(6,10-2)17(23-18)13-12-15-22-24(7,8)19(3,4)5/h10,17-18H,2,9,11-16H2,1,3-8H3/t17-,18?,20+/m0/s1.
What are the key properties of 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane?
3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane has a molecular weight of 356.62 g/mol, XLogP of 5.91, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,3S)-5-butoxy-3-ethenyl-3-methyloxolan-2-yl]propoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 134867225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).