C12H21O3P — CID 134867268
3-[ethoxy(prop-2-enoxy)phosphoryl]hepta-1,2-diene (PubChem CID 134867268) has the molecular formula C12H21O3P and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-[ethoxy(prop-2-enoxy)phosphoryl]hepta-1,2-diene.
| Compound Name | 3-[ethoxy(prop-2-enoxy)phosphoryl]hepta-1,2-diene |
|---|---|
| PubChem CID | 134867268 |
| Molecular Formula | C12H21O3P |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-[ethoxy(prop-2-enoxy)phosphoryl]hepta-1,2-diene |
| SMILES | C=C=C(CCCC)P(=O)(OCC)OCC=C |
| InChI | InChI=1S/C12H21O3P/c1-5-9-10-12(7-3)16(13,14-8-4)15-11-6-2/h6H,2-3,5,8-11H2,1,4H3 |
| InChIKey | FKDBXXCTKYELOI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|