C23H35NO4 — CID 134867310
benzyl 2-[(3aR,7S)-7-(1-hydroxypentan-2-yl)-7-methyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-a]pyridin-2-yl]propanoate (PubChem CID 134867310) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is benzyl 2-[(3aR,7S)-7-(1-hydroxypentan-2-yl)-7-methyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-a]pyridin-2-yl]propanoate.
| Compound Name | benzyl 2-[(3aR,7S)-7-(1-hydroxypentan-2-yl)-7-methyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-a]pyridin-2-yl]propanoate |
|---|---|
| PubChem CID | 134867310 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | benzyl 2-[(3aR,7S)-7-(1-hydroxypentan-2-yl)-7-methyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-a]pyridin-2-yl]propanoate |
| SMILES | CCCC(CO)[C@]1(C)CCC[C@@H]2CC(C(C)C(=O)OCc3ccccc3)ON21 |
| InChI | InChI=1S/C23H35NO4/c1-4-9-19(15-25)23(3)13-8-12-20-14-21(28-24(20)23)17(2)22(26)27-16-18-10-6-5-7-11-18/h5-7,10-11,17,19-21,25H,4,8-9,12-16H2,1-3H3/t17?,19?,20-,21?,23+/m1/s1 |
| InChIKey | XRFOYHXGQNPREM-IWUOBKCYSA-N |
| XLogP | 4.09 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |