About (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one
(5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one (PubChem CID 134867606) has the molecular formula C30H27NO2
and a molecular weight of 433.55 g/mol. Its IUPAC name is (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one.
Molecular Properties
| Compound Name | (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one |
| PubChem CID | 134867606 |
| Molecular Formula | C30H27NO2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one |
| SMILES | Cc1ccc(C(CC(=O)c2ccccc2)C(/C(=N\O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27NO2/c1-22-17-19-23(20-18-22)27(21-28(32)24-11-5-2-6-12-24)29(25-13-7-3-8-14-25)30(31-33)26-15-9-4-10-16-26/h2-20,27,29,33H,21H2,1H3/b31-30- |
| InChIKey | GEBNHFGYZZTWKO-KTMFPKCZSA-N |
| XLogP | 7.01 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one?
The IUPAC name of (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one (CID 134867606) is (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one.
What is the SMILES notation for (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one?
The canonical SMILES for (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one is Cc1ccc(C(CC(=O)c2ccccc2)C(/C(=N\O)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one?
The InChIKey is GEBNHFGYZZTWKO-KTMFPKCZSA-N. The full InChI is InChI=1S/C30H27NO2/c1-22-17-19-23(20-18-22)27(21-28(32)24-11-5-2-6-12-24)29(25-13-7-3-8-14-25)30(31-33)26-15-9-4-10-16-26/h2-20,27,29,33H,21H2,1H3/b31-30-.
What are the key properties of (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one?
(5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one has a molecular weight of 433.55 g/mol, XLogP of 7.01, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-hydroxyimino-3-(4-methylphenyl)-1,4,5-triphenylpentan-1-one is sourced from PubChem (CID 134867606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).